C16H19BFNO2 — CID 157033316
2-fluoro-3-[(1S,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]benzonitrile (PubChem CID 157033316) has the molecular formula C16H19BFNO2 and a molecular weight of 287.14 g/mol. Its IUPAC name is 2-fluoro-3-[(1S,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]benzonitrile.
| Compound Name | 2-fluoro-3-[(1S,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]benzonitrile |
|---|---|
| PubChem CID | 157033316 |
| Molecular Formula | C16H19BFNO2 |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-fluoro-3-[(1S,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]benzonitrile |
| SMILES | CC1(C)OB([C@H]2C[C@@H]2c2cccc(C#N)c2F)OC1(C)C |
| InChI | InChI=1S/C16H19BFNO2/c1-15(2)16(3,4)21-17(20-15)13-8-12(13)11-7-5-6-10(9-19)14(11)18/h5-7,12-13H,8H2,1-4H3/t12-,13+/m1/s1 |
| InChIKey | MGFDLSVCVHRIPI-OLZOCXBDSA-N |
| XLogP | 3.65 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|