C17H11ClF4N6 — CID 157033432
6-chloro-8-[(1S,2S)-2-[7-fluoro-1-(2,2,2-trifluoroethyl)indazol-6-yl]cyclopropyl]-[1,2,4]triazolo[1,5-b]pyridazine (PubChem CID 157033432) has the molecular formula C17H11ClF4N6 and a molecular weight of 410.76 g/mol. Its IUPAC name is 6-chloro-8-[(1S,2S)-2-[7-fluoro-1-(2,2,2-trifluoroethyl)indazol-6-yl]cyclopropyl]-[1,2,4]triazolo[1,5-b]pyridazine.
| Compound Name | 6-chloro-8-[(1S,2S)-2-[7-fluoro-1-(2,2,2-trifluoroethyl)indazol-6-yl]cyclopropyl]-[1,2,4]triazolo[1,5-b]pyridazine |
|---|---|
| PubChem CID | 157033432 |
| Molecular Formula | C17H11ClF4N6 |
| Molecular Weight | 410.76 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 6-chloro-8-[(1S,2S)-2-[7-fluoro-1-(2,2,2-trifluoroethyl)indazol-6-yl]cyclopropyl]-[1,2,4]triazolo[1,5-b]pyridazine |
| SMILES | Fc1c([C@H]2C[C@@H]2c2cc(Cl)nn3ncnc23)ccc2cnn(CC(F)(F)F)c12 |
| InChI | InChI=1S/C17H11ClF4N6/c18-13-4-12(16-23-7-25-28(16)26-13)11-3-10(11)9-2-1-8-5-24-27(6-17(20,21)22)15(8)14(9)19/h1-2,4-5,7,10-11H,3,6H2/t10-,11+/m1/s1 |
| InChIKey | JQAKJGQNKSMVRN-MNOVXSKESA-N |
| XLogP | 4.10 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |