C9H4ClF6N3 — CID 157033828
6-chloro-1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrazolo[4,3-c]pyridine (PubChem CID 157033828) has the molecular formula C9H4ClF6N3 and a molecular weight of 303.59 g/mol. Its IUPAC name is 6-chloro-1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrazolo[4,3-c]pyridine.
| Compound Name | 6-chloro-1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 157033828 |
| Molecular Formula | C9H4ClF6N3 |
| Molecular Weight | 303.59 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 6-chloro-1-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)pyrazolo[4,3-c]pyridine |
| SMILES | FC(F)(F)Cn1nc(C(F)(F)F)c2cnc(Cl)cc21 |
| InChI | InChI=1S/C9H4ClF6N3/c10-6-1-5-4(2-17-6)7(9(14,15)16)18-19(5)3-8(11,12)13/h1-2H,3H2 |
| InChIKey | YBSFMOCDEIUEJS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|