C10H6ClF3N2O — CID 157038129
6-chloro-2-(2,2,2-trifluoroethyl)-2,7-naphthyridin-1-one (PubChem CID 157038129) has the molecular formula C10H6ClF3N2O and a molecular weight of 262.62 g/mol. Its IUPAC name is 6-chloro-2-(2,2,2-trifluoroethyl)-2,7-naphthyridin-1-one.
| Compound Name | 6-chloro-2-(2,2,2-trifluoroethyl)-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 157038129 |
| Molecular Formula | C10H6ClF3N2O |
| Molecular Weight | 262.62 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 6-chloro-2-(2,2,2-trifluoroethyl)-2,7-naphthyridin-1-one |
| SMILES | O=c1c2cnc(Cl)cc2ccn1CC(F)(F)F |
| InChI | InChI=1S/C10H6ClF3N2O/c11-8-3-6-1-2-16(5-10(12,13)14)9(17)7(6)4-15-8/h1-4H,5H2 |
| InChIKey | YWRUCCYMDNCYOI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.62 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|