C9H6F4N2 — CID 157032549
3-fluoro-1-(2,2,2-trifluoroethyl)indazole (PubChem CID 157032549) has the molecular formula C9H6F4N2 and a molecular weight of 218.15 g/mol. Its IUPAC name is 3-fluoro-1-(2,2,2-trifluoroethyl)indazole.
| Compound Name | 3-fluoro-1-(2,2,2-trifluoroethyl)indazole |
|---|---|
| PubChem CID | 157032549 |
| Molecular Formula | C9H6F4N2 |
| Molecular Weight | 218.15 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 3-fluoro-1-(2,2,2-trifluoroethyl)indazole |
| SMILES | Fc1nn(CC(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C9H6F4N2/c10-8-6-3-1-2-4-7(6)15(14-8)5-9(11,12)13/h1-4H,5H2 |
| InChIKey | FRFVBRCYVUGJGL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.15 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |