C22H26Cl2N4O4 — CID 157035669
N-[(2S)-3-(carbamoylamino)-1-hydroxy-1-methoxypropan-2-yl]-2,6-dichloro-3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzamide (PubChem CID 157035669) has the molecular formula C22H26Cl2N4O4 and a molecular weight of 481.38 g/mol. Its IUPAC name is N-[(2S)-3-(carbamoylamino)-1-hydroxy-1-methoxypropan-2-yl]-2,6-dichloro-3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzamide.
| Compound Name | N-[(2S)-3-(carbamoylamino)-1-hydroxy-1-methoxypropan-2-yl]-2,6-dichloro-3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzamide |
|---|---|
| PubChem CID | 157035669 |
| Molecular Formula | C22H26Cl2N4O4 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | N-[(2S)-3-(carbamoylamino)-1-hydroxy-1-methoxypropan-2-yl]-2,6-dichloro-3-(1,2,3,4-tetrahydronaphthalen-2-ylamino)benzamide |
| SMILES | COC(O)[C@H](CNC(N)=O)NC(=O)c1c(Cl)ccc(NC2CCc3ccccc3C2)c1Cl |
| InChI | InChI=1S/C22H26Cl2N4O4/c1-32-21(30)17(11-26-22(25)31)28-20(29)18-15(23)8-9-16(19(18)24)27-14-7-6-12-4-2-3-5-13(12)10-14/h2-5,8-9,14,17,21,27,30H,6-7,10-11H2,1H3,(H,28,29)(H3,25,26,31)/t14?,17-,21?/m0/s1 |
| InChIKey | IDWWQFTZHBIMDJ-XZSJUEPFSA-N |
| XLogP | 2.69 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|