C27H23ClIN6- — CID 157036629
5-[6-(3-chloro-4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]-2-ethenyliodanuidylquinoline (PubChem CID 157036629) has the molecular formula C27H23ClIN6- and a molecular weight of 593.88 g/mol. Its IUPAC name is 5-[6-(3-chloro-4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]-2-ethenyliodanuidylquinoline.
| Compound Name | 5-[6-(3-chloro-4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]-2-ethenyliodanuidylquinoline |
|---|---|
| PubChem CID | 157036629 |
| Molecular Formula | C27H23ClIN6- |
| Molecular Weight | 593.88 g/mol |
| Exact Mass | 593.07 |
| IUPAC Name | 5-[6-(3-chloro-4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]-2-ethenyliodanuidylquinoline |
| SMILES | C=C[I-]c1ccc2c(-c3cnn4cc(-c5ccc(N6CCNCC6)c(Cl)c5)cnc34)cccc2n1 |
| InChI | InChI=1S/C27H23ClIN6/c1-2-29-26-9-7-21-20(4-3-5-24(21)33-26)22-16-32-35-17-19(15-31-27(22)35)18-6-8-25(23(28)14-18)34-12-10-30-11-13-34/h2-9,14-17,30H,1,10-13H2/q-1 |
| InChIKey | CVUNMVDPAWSEFP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.88 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|