C30H33N7 — CID 163296493
ethene;2-methyl-5-[6-[5-(3-piperazin-1-ylpropyl)-2-pyridinyl]pyrazolo[1,5-a]pyrimidin-3-yl]quinoline (PubChem CID 163296493) has the molecular formula C30H33N7 and a molecular weight of 491.64 g/mol. Its IUPAC name is ethene;2-methyl-5-[6-[5-(3-piperazin-1-ylpropyl)-2-pyridinyl]pyrazolo[1,5-a]pyrimidin-3-yl]quinoline.
| Compound Name | ethene;2-methyl-5-[6-[5-(3-piperazin-1-ylpropyl)-2-pyridinyl]pyrazolo[1,5-a]pyrimidin-3-yl]quinoline |
|---|---|
| PubChem CID | 163296493 |
| Molecular Formula | C30H33N7 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | ethene;2-methyl-5-[6-[5-(3-piperazin-1-ylpropyl)-2-pyridinyl]pyrazolo[1,5-a]pyrimidin-3-yl]quinoline |
| SMILES | C=C.Cc1ccc2c(-c3cnn4cc(-c5ccc(CCCN6CCNCC6)cn5)cnc34)cccc2n1 |
| InChI | InChI=1S/C28H29N7.C2H4/c1-20-7-9-24-23(5-2-6-27(24)33-20)25-18-32-35-19-22(17-31-28(25)35)26-10-8-21(16-30-26)4-3-13-34-14-11-29-12-15-34;1-2/h2,5-10,16-19,29H,3-4,11-15H2,1H3;1-2H2 |
| InChIKey | UAFRESXSGXSBKW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|