C27H26N6S — CID 167058498
N-[5-[6-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]naphthalen-1-yl]sulfanylmethanamine (PubChem CID 167058498) has the molecular formula C27H26N6S and a molecular weight of 466.61 g/mol. Its IUPAC name is N-[5-[6-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]naphthalen-1-yl]sulfanylmethanamine.
| Compound Name | N-[5-[6-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]naphthalen-1-yl]sulfanylmethanamine |
|---|---|
| PubChem CID | 167058498 |
| Molecular Formula | C27H26N6S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N-[5-[6-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]naphthalen-1-yl]sulfanylmethanamine |
| SMILES | CNSc1cccc2c(-c3cnn4cc(-c5ccc(N6CCNCC6)cc5)cnc34)cccc12 |
| InChI | InChI=1S/C27H26N6S/c1-28-34-26-7-3-5-22-23(4-2-6-24(22)26)25-17-31-33-18-20(16-30-27(25)33)19-8-10-21(11-9-19)32-14-12-29-13-15-32/h2-11,16-18,28-29H,12-15H2,1H3 |
| InChIKey | GBJUSHGNVKKRGN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 57.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|