C23H23N7O — CID 140797509
N'-hydroxy-4-[6-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]benzenecarboximidamide (PubChem CID 140797509) has the molecular formula C23H23N7O and a molecular weight of 413.49 g/mol. Its IUPAC name is N'-hydroxy-4-[6-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[6-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 140797509 |
| Molecular Formula | C23H23N7O |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | N'-hydroxy-4-[6-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]benzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(-c2cnn3cc(-c4ccc(N5CCNCC5)cc4)cnc23)cc1 |
| InChI | InChI=1S/C23H23N7O/c24-22(28-31)18-3-1-17(2-4-18)21-14-27-30-15-19(13-26-23(21)30)16-5-7-20(8-6-16)29-11-9-25-10-12-29/h1-8,13-15,25,31H,9-12H2,(H2,24,28) |
| InChIKey | UNZRSHNYMKCNJH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|