C25H25F3N5S+ — CID 163291590
dimethyl-[3-[6-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]-5-(trifluoromethyl)phenyl]sulfanium (PubChem CID 163291590) has the molecular formula C25H25F3N5S+ and a molecular weight of 484.57 g/mol. Its IUPAC name is dimethyl-[3-[6-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]-5-(trifluoromethyl)phenyl]sulfanium.
| Compound Name | dimethyl-[3-[6-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]-5-(trifluoromethyl)phenyl]sulfanium |
|---|---|
| PubChem CID | 163291590 |
| Molecular Formula | C25H25F3N5S+ |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | dimethyl-[3-[6-(4-piperazin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]-5-(trifluoromethyl)phenyl]sulfanium |
| SMILES | C[S+](C)c1cc(-c2cnn3cc(-c4ccc(N5CCNCC5)cc4)cnc23)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H25F3N5S/c1-34(2)22-12-18(11-20(13-22)25(26,27)28)23-15-31-33-16-19(14-30-24(23)33)17-3-5-21(6-4-17)32-9-7-29-8-10-32/h3-6,11-16,29H,7-10H2,1-2H3/q+1 |
| InChIKey | IGXAORVYDYWHQG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|