C25H22N6 — CID 163296473
4-[6-(4-imidazolidin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]naphthalen-2-amine (PubChem CID 163296473) has the molecular formula C25H22N6 and a molecular weight of 406.49 g/mol. Its IUPAC name is 4-[6-(4-imidazolidin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]naphthalen-2-amine.
| Compound Name | 4-[6-(4-imidazolidin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]naphthalen-2-amine |
|---|---|
| PubChem CID | 163296473 |
| Molecular Formula | C25H22N6 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 4-[6-(4-imidazolidin-1-ylphenyl)pyrazolo[1,5-a]pyrimidin-3-yl]naphthalen-2-amine |
| SMILES | Nc1cc(-c2cnn3cc(-c4ccc(N5CCNC5)cc4)cnc23)c2ccccc2c1 |
| InChI | InChI=1S/C25H22N6/c26-20-11-18-3-1-2-4-22(18)23(12-20)24-14-29-31-15-19(13-28-25(24)31)17-5-7-21(8-6-17)30-10-9-27-16-30/h1-8,11-15,27H,9-10,16,26H2 |
| InChIKey | LNKJHEJXGQRLFS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|