C11H20N2O — CID 157037980
N-[(E)-2-ethenyl-3-methyl-4-methyliminobut-2-enyl]propanamide;molecular hydrogen (PubChem CID 157037980) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is N-[(E)-2-ethenyl-3-methyl-4-methyliminobut-2-enyl]propanamide;molecular hydrogen.
| Compound Name | N-[(E)-2-ethenyl-3-methyl-4-methyliminobut-2-enyl]propanamide;molecular hydrogen |
|---|---|
| PubChem CID | 157037980 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | N-[(E)-2-ethenyl-3-methyl-4-methyliminobut-2-enyl]propanamide;molecular hydrogen |
| SMILES | C=C/C(CNC(=O)CC)=C(C)\C=N\C.[H][H] |
| InChI | InChI=1S/C11H18N2O.H2/c1-5-10(9(3)7-12-4)8-13-11(14)6-2;/h5,7H,1,6,8H2,2-4H3,(H,13,14);1H/b10-9+,12-7+; |
| InChIKey | FSBVHKLEBCFUPM-RVWBRHCMSA-N |
| XLogP | 1.96 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|