C24H26ClN7 — CID 157038268
3-(2-chloro-6-methyl-4-pyridinyl)-2-[3-(methylamino)phenyl]-N-piperidin-4-ylpyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 157038268) has the molecular formula C24H26ClN7 and a molecular weight of 447.97 g/mol. Its IUPAC name is 3-(2-chloro-6-methyl-4-pyridinyl)-2-[3-(methylamino)phenyl]-N-piperidin-4-ylpyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | 3-(2-chloro-6-methyl-4-pyridinyl)-2-[3-(methylamino)phenyl]-N-piperidin-4-ylpyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 157038268 |
| Molecular Formula | C24H26ClN7 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 3-(2-chloro-6-methyl-4-pyridinyl)-2-[3-(methylamino)phenyl]-N-piperidin-4-ylpyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | CNc1cccc(-c2nn3ccc(NC4CCNCC4)nc3c2-c2cc(C)nc(Cl)c2)c1 |
| InChI | InChI=1S/C24H26ClN7/c1-15-12-17(14-20(25)28-15)22-23(16-4-3-5-19(13-16)26-2)31-32-11-8-21(30-24(22)32)29-18-6-9-27-10-7-18/h3-5,8,11-14,18,26-27H,6-7,9-10H2,1-2H3,(H,29,30) |
| InChIKey | AIFWEMMFBMJAGP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|