C23H19ClN6O — CID 157038432
3-[3-(2-chloro-6-methyl-4-pyridinyl)-5-[[(3S)-oxolan-3-yl]amino]pyrazolo[1,5-a]pyrimidin-2-yl]benzonitrile (PubChem CID 157038432) has the molecular formula C23H19ClN6O and a molecular weight of 430.90 g/mol. Its IUPAC name is 3-[3-(2-chloro-6-methyl-4-pyridinyl)-5-[[(3S)-oxolan-3-yl]amino]pyrazolo[1,5-a]pyrimidin-2-yl]benzonitrile.
| Compound Name | 3-[3-(2-chloro-6-methyl-4-pyridinyl)-5-[[(3S)-oxolan-3-yl]amino]pyrazolo[1,5-a]pyrimidin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 157038432 |
| Molecular Formula | C23H19ClN6O |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 3-[3-(2-chloro-6-methyl-4-pyridinyl)-5-[[(3S)-oxolan-3-yl]amino]pyrazolo[1,5-a]pyrimidin-2-yl]benzonitrile |
| SMILES | Cc1cc(-c2c(-c3cccc(C#N)c3)nn3ccc(N[C@H]4CCOC4)nc23)cc(Cl)n1 |
| InChI | InChI=1S/C23H19ClN6O/c1-14-9-17(11-19(24)26-14)21-22(16-4-2-3-15(10-16)12-25)29-30-7-5-20(28-23(21)30)27-18-6-8-31-13-18/h2-5,7,9-11,18H,6,8,13H2,1H3,(H,27,28)/t18-/m0/s1 |
| InChIKey | OCEXKHNSXPSCST-SFHVURJKSA-N |
| XLogP | 4.49 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|