C22H19ClN8O — CID 157038390
1-(2-aminoethyl)-3-[3-(2-chloro-6-methyl-4-pyridinyl)-2-(3-cyanophenyl)pyrazolo[1,5-a]pyrimidin-5-yl]urea (PubChem CID 157038390) has the molecular formula C22H19ClN8O and a molecular weight of 446.90 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-[3-(2-chloro-6-methyl-4-pyridinyl)-2-(3-cyanophenyl)pyrazolo[1,5-a]pyrimidin-5-yl]urea.
| Compound Name | 1-(2-aminoethyl)-3-[3-(2-chloro-6-methyl-4-pyridinyl)-2-(3-cyanophenyl)pyrazolo[1,5-a]pyrimidin-5-yl]urea |
|---|---|
| PubChem CID | 157038390 |
| Molecular Formula | C22H19ClN8O |
| Molecular Weight | 446.90 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 1-(2-aminoethyl)-3-[3-(2-chloro-6-methyl-4-pyridinyl)-2-(3-cyanophenyl)pyrazolo[1,5-a]pyrimidin-5-yl]urea |
| SMILES | Cc1cc(-c2c(-c3cccc(C#N)c3)nn3ccc(NC(=O)NCCN)nc23)cc(Cl)n1 |
| InChI | InChI=1S/C22H19ClN8O/c1-13-9-16(11-17(23)27-13)19-20(15-4-2-3-14(10-15)12-25)30-31-8-5-18(28-21(19)31)29-22(32)26-7-6-24/h2-5,8-11H,6-7,24H2,1H3,(H2,26,28,29,32) |
| InChIKey | PCXXWBMPENCAQR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.90 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|