C23H19ClN6O2 — CID 157038459
3-[3-(2-chloro-6-methyl-4-pyridinyl)-5-[(4-hydroxyoxolan-3-yl)amino]pyrazolo[1,5-a]pyrimidin-2-yl]benzonitrile (PubChem CID 157038459) has the molecular formula C23H19ClN6O2 and a molecular weight of 446.90 g/mol. Its IUPAC name is 3-[3-(2-chloro-6-methyl-4-pyridinyl)-5-[(4-hydroxyoxolan-3-yl)amino]pyrazolo[1,5-a]pyrimidin-2-yl]benzonitrile.
| Compound Name | 3-[3-(2-chloro-6-methyl-4-pyridinyl)-5-[(4-hydroxyoxolan-3-yl)amino]pyrazolo[1,5-a]pyrimidin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 157038459 |
| Molecular Formula | C23H19ClN6O2 |
| Molecular Weight | 446.90 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 3-[3-(2-chloro-6-methyl-4-pyridinyl)-5-[(4-hydroxyoxolan-3-yl)amino]pyrazolo[1,5-a]pyrimidin-2-yl]benzonitrile |
| SMILES | Cc1cc(-c2c(-c3cccc(C#N)c3)nn3ccc(NC4COCC4O)nc23)cc(Cl)n1 |
| InChI | InChI=1S/C23H19ClN6O2/c1-13-7-16(9-19(24)26-13)21-22(15-4-2-3-14(8-15)10-25)29-30-6-5-20(28-23(21)30)27-17-11-32-12-18(17)31/h2-9,17-18,31H,11-12H2,1H3,(H,27,28) |
| InChIKey | SOSDXHQMEOBRJY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.90 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|