C26H21ClN6O2 — CID 166829313
3-[3-(2-chloro-6-methyl-4-pyridinyl)-5-[[(1R)-1-[(6S)-4,7-dioxaspiro[2.4]hept-1-en-6-yl]ethyl]amino]pyrazolo[1,5-a]pyrimidin-2-yl]benzonitrile (PubChem CID 166829313) has the molecular formula C26H21ClN6O2 and a molecular weight of 484.95 g/mol. Its IUPAC name is 3-[3-(2-chloro-6-methyl-4-pyridinyl)-5-[[(1R)-1-[(6S)-4,7-dioxaspiro[2.4]hept-1-en-6-yl]ethyl]amino]pyrazolo[1,5-a]pyrimidin-2-yl]benzonitrile.
| Compound Name | 3-[3-(2-chloro-6-methyl-4-pyridinyl)-5-[[(1R)-1-[(6S)-4,7-dioxaspiro[2.4]hept-1-en-6-yl]ethyl]amino]pyrazolo[1,5-a]pyrimidin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 166829313 |
| Molecular Formula | C26H21ClN6O2 |
| Molecular Weight | 484.95 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 3-[3-(2-chloro-6-methyl-4-pyridinyl)-5-[[(1R)-1-[(6S)-4,7-dioxaspiro[2.4]hept-1-en-6-yl]ethyl]amino]pyrazolo[1,5-a]pyrimidin-2-yl]benzonitrile |
| SMILES | Cc1cc(-c2c(-c3cccc(C#N)c3)nn3ccc(N[C@H](C)[C@H]4COC5(C=C5)O4)nc23)cc(Cl)n1 |
| InChI | InChI=1S/C26H21ClN6O2/c1-15-10-19(12-21(27)29-15)23-24(18-5-3-4-17(11-18)13-28)32-33-9-6-22(31-25(23)33)30-16(2)20-14-34-26(35-20)7-8-26/h3-12,16,20H,14H2,1-2H3,(H,30,31)/t16-,20-/m1/s1 |
| InChIKey | NTVUTSOHANXKCO-OXQOHEQNSA-N |
| XLogP | 4.77 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.95 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|