C18H33NO3 — CID 157039808
(3S,6R)-6-(hydroxymethyl)-1-[4-(3-methyl-5-methylidenecyclohexyl)butyl]piperidine-3,4-diol (PubChem CID 157039808) has the molecular formula C18H33NO3 and a molecular weight of 311.47 g/mol. Its IUPAC name is (3S,6R)-6-(hydroxymethyl)-1-[4-(3-methyl-5-methylidenecyclohexyl)butyl]piperidine-3,4-diol.
| Compound Name | (3S,6R)-6-(hydroxymethyl)-1-[4-(3-methyl-5-methylidenecyclohexyl)butyl]piperidine-3,4-diol |
|---|---|
| PubChem CID | 157039808 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | (3S,6R)-6-(hydroxymethyl)-1-[4-(3-methyl-5-methylidenecyclohexyl)butyl]piperidine-3,4-diol |
| SMILES | C=C1CC(C)CC(CCCCN2C[C@H](O)C(O)C[C@@H]2CO)C1 |
| InChI | InChI=1S/C18H33NO3/c1-13-7-14(2)9-15(8-13)5-3-4-6-19-11-18(22)17(21)10-16(19)12-20/h14-18,20-22H,1,3-12H2,2H3/t14?,15?,16-,17?,18+/m1/s1 |
| InChIKey | MMCYBZBEAXTZEF-CHKQFIRCSA-N |
| XLogP | 1.94 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|