C11H11F3N2O5 — CID 157042315
1-(1,4-dioxan-2-ylmethyl)-3-nitro-5-(trifluoromethyl)pyridin-2-one (PubChem CID 157042315) has the molecular formula C11H11F3N2O5 and a molecular weight of 308.21 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-ylmethyl)-3-nitro-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-(1,4-dioxan-2-ylmethyl)-3-nitro-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 157042315 |
| Molecular Formula | C11H11F3N2O5 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 1-(1,4-dioxan-2-ylmethyl)-3-nitro-5-(trifluoromethyl)pyridin-2-one |
| SMILES | O=c1c([N+](=O)[O-])cc(C(F)(F)F)cn1CC1COCCO1 |
| InChI | InChI=1S/C11H11F3N2O5/c12-11(13,14)7-3-9(16(18)19)10(17)15(4-7)5-8-6-20-1-2-21-8/h3-4,8H,1-2,5-6H2 |
| InChIKey | GEYDZVQVBJWCNU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 83.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|