C12H13F3N2O5 — CID 166507282
1-[(3R,4R)-4-methoxyoxan-3-yl]-3-nitro-5-(trifluoromethyl)pyridin-2-one (PubChem CID 166507282) has the molecular formula C12H13F3N2O5 and a molecular weight of 322.24 g/mol. Its IUPAC name is 1-[(3R,4R)-4-methoxyoxan-3-yl]-3-nitro-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[(3R,4R)-4-methoxyoxan-3-yl]-3-nitro-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 166507282 |
| Molecular Formula | C12H13F3N2O5 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 1-[(3R,4R)-4-methoxyoxan-3-yl]-3-nitro-5-(trifluoromethyl)pyridin-2-one |
| SMILES | CO[C@@H]1CCOC[C@H]1n1cc(C(F)(F)F)cc([N+](=O)[O-])c1=O |
| InChI | InChI=1S/C12H13F3N2O5/c1-21-10-2-3-22-6-9(10)16-5-7(12(13,14)15)4-8(11(16)18)17(19)20/h4-5,9-10H,2-3,6H2,1H3/t9-,10-/m1/s1 |
| InChIKey | YLLNIFVERXSAJN-NXEZZACHSA-N |
| XLogP | 1.75 |
| TPSA | 83.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|