C12H15F3N2O3 — CID 157041573
3-amino-1-(4-methoxyoxan-3-yl)-5-(trifluoromethyl)pyridin-2-one (PubChem CID 157041573) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is 3-amino-1-(4-methoxyoxan-3-yl)-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 3-amino-1-(4-methoxyoxan-3-yl)-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 157041573 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 3-amino-1-(4-methoxyoxan-3-yl)-5-(trifluoromethyl)pyridin-2-one |
| SMILES | COC1CCOCC1n1cc(C(F)(F)F)cc(N)c1=O |
| InChI | InChI=1S/C12H15F3N2O3/c1-19-10-2-3-20-6-9(10)17-5-7(12(13,14)15)4-8(16)11(17)18/h4-5,9-10H,2-3,6,16H2,1H3 |
| InChIKey | LUVNSLORKQXPKJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |