C13H13F3N2O3S — CID 157042278
3-isothiocyanato-1-[(3R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 157042278) has the molecular formula C13H13F3N2O3S and a molecular weight of 334.32 g/mol. Its IUPAC name is 3-isothiocyanato-1-[(3R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 3-isothiocyanato-1-[(3R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 157042278 |
| Molecular Formula | C13H13F3N2O3S |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 3-isothiocyanato-1-[(3R)-4-methoxyoxan-3-yl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | COC1CCOC[C@H]1n1cc(C(F)(F)F)cc(N=C=S)c1=O |
| InChI | InChI=1S/C13H13F3N2O3S/c1-20-11-2-3-21-6-10(11)18-5-8(13(14,15)16)4-9(12(18)19)17-7-22/h4-5,10-11H,2-3,6H2,1H3/t10-,11?/m1/s1 |
| InChIKey | NLSLQOSOCRBZKH-NFJWQWPMSA-N |
| XLogP | 2.58 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|