C11H11F3N2O5 — CID 166507338
1-[(3S,4R)-3-hydroxyoxan-4-yl]-3-nitro-5-(trifluoromethyl)pyridin-2-one (PubChem CID 166507338) has the molecular formula C11H11F3N2O5 and a molecular weight of 308.21 g/mol. Its IUPAC name is 1-[(3S,4R)-3-hydroxyoxan-4-yl]-3-nitro-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[(3S,4R)-3-hydroxyoxan-4-yl]-3-nitro-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 166507338 |
| Molecular Formula | C11H11F3N2O5 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 1-[(3S,4R)-3-hydroxyoxan-4-yl]-3-nitro-5-(trifluoromethyl)pyridin-2-one |
| SMILES | O=c1c([N+](=O)[O-])cc(C(F)(F)F)cn1[C@@H]1CCOC[C@H]1O |
| InChI | InChI=1S/C11H11F3N2O5/c12-11(13,14)6-3-8(16(19)20)10(18)15(4-6)7-1-2-21-5-9(7)17/h3-4,7,9,17H,1-2,5H2/t7-,9-/m1/s1 |
| InChIKey | VKFGPVZLHHRJCU-VXNVDRBHSA-N |
| XLogP | 1.10 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|