C24H19ClN4O2 — CID 157043679
4-[(3-chloro-2-methyl-4-pyridinyl)amino]-N-(3-pyridin-4-yloxyphenyl)benzamide (PubChem CID 157043679) has the molecular formula C24H19ClN4O2 and a molecular weight of 430.90 g/mol. Its IUPAC name is 4-[(3-chloro-2-methyl-4-pyridinyl)amino]-N-(3-pyridin-4-yloxyphenyl)benzamide.
| Compound Name | 4-[(3-chloro-2-methyl-4-pyridinyl)amino]-N-(3-pyridin-4-yloxyphenyl)benzamide |
|---|---|
| PubChem CID | 157043679 |
| Molecular Formula | C24H19ClN4O2 |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-[(3-chloro-2-methyl-4-pyridinyl)amino]-N-(3-pyridin-4-yloxyphenyl)benzamide |
| SMILES | Cc1nccc(Nc2ccc(C(=O)Nc3cccc(Oc4ccncc4)c3)cc2)c1Cl |
| InChI | InChI=1S/C24H19ClN4O2/c1-16-23(25)22(11-14-27-16)28-18-7-5-17(6-8-18)24(30)29-19-3-2-4-21(15-19)31-20-9-12-26-13-10-20/h2-15H,1H3,(H,27,28)(H,29,30) |
| InChIKey | KZRXGPQEULAHFS-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |