C24H22ClF2N5O — CID 157045501
4-(4-chloro-2,3-difluorophenyl)-7-methylpteridine;2-methyl-4-(oxan-2-yl)pyridine (PubChem CID 157045501) has the molecular formula C24H22ClF2N5O and a molecular weight of 469.92 g/mol. Its IUPAC name is 4-(4-chloro-2,3-difluorophenyl)-7-methylpteridine;2-methyl-4-(oxan-2-yl)pyridine.
| Compound Name | 4-(4-chloro-2,3-difluorophenyl)-7-methylpteridine;2-methyl-4-(oxan-2-yl)pyridine |
|---|---|
| PubChem CID | 157045501 |
| Molecular Formula | C24H22ClF2N5O |
| Molecular Weight | 469.92 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 4-(4-chloro-2,3-difluorophenyl)-7-methylpteridine;2-methyl-4-(oxan-2-yl)pyridine |
| SMILES | Cc1cc(C2CCCCO2)ccn1.Cc1cnc2c(-c3ccc(Cl)c(F)c3F)ncnc2n1 |
| InChI | InChI=1S/C13H7ClF2N4.C11H15NO/c1-6-4-17-12-11(18-5-19-13(12)20-6)7-2-3-8(14)10(16)9(7)15;1-9-8-10(5-6-12-9)11-4-2-3-7-13-11/h2-5H,1H3;5-6,8,11H,2-4,7H2,1H3 |
| InChIKey | JWKDVTWWTGYVON-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 73.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.92 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|