C25H27ClFN5O2 — CID 157045780
4-(4-chloro-2-fluorophenyl)-6,7-dimethylpteridine;2-methoxypyridine;oxane (PubChem CID 157045780) has the molecular formula C25H27ClFN5O2 and a molecular weight of 483.98 g/mol. Its IUPAC name is 4-(4-chloro-2-fluorophenyl)-6,7-dimethylpteridine;2-methoxypyridine;oxane.
| Compound Name | 4-(4-chloro-2-fluorophenyl)-6,7-dimethylpteridine;2-methoxypyridine;oxane |
|---|---|
| PubChem CID | 157045780 |
| Molecular Formula | C25H27ClFN5O2 |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 4-(4-chloro-2-fluorophenyl)-6,7-dimethylpteridine;2-methoxypyridine;oxane |
| SMILES | C1CCOCC1.COc1ccccn1.Cc1nc2ncnc(-c3ccc(Cl)cc3F)c2nc1C |
| InChI | InChI=1S/C14H10ClFN4.C6H7NO.C5H10O/c1-7-8(2)20-14-13(19-7)12(17-6-18-14)10-4-3-9(15)5-11(10)16;1-8-6-4-2-3-5-7-6;1-2-4-6-5-3-1/h3-6H,1-2H3;2-5H,1H3;1-5H2 |
| InChIKey | YASPFGPQQYTLOG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 82.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |