C33H45F3N6O3SSi — CID 157047575
N-(1-methylpiperidin-4-yl)-2-[5-[(4-methylsulfonylanilino)methyl]-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 157047575) has the molecular formula C33H45F3N6O3SSi and a molecular weight of 690.91 g/mol. Its IUPAC name is N-(1-methylpiperidin-4-yl)-2-[5-[(4-methylsulfonylanilino)methyl]-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | N-(1-methylpiperidin-4-yl)-2-[5-[(4-methylsulfonylanilino)methyl]-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 157047575 |
| Molecular Formula | C33H45F3N6O3SSi |
| Molecular Weight | 690.91 g/mol |
| Exact Mass | 690.30 |
| IUPAC Name | N-(1-methylpiperidin-4-yl)-2-[5-[(4-methylsulfonylanilino)methyl]-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | CN1CCC(Nc2cccc3c2cc(-c2cc(CNc4ccc(S(C)(=O)=O)cc4)n(COCC[Si](C)(C)C)n2)n3CC(F)(F)F)CC1 |
| InChI | InChI=1S/C33H45F3N6O3SSi/c1-40-15-13-25(14-16-40)38-29-7-6-8-31-28(29)20-32(41(31)22-33(34,35)36)30-19-26(42(39-30)23-45-17-18-47(3,4)5)21-37-24-9-11-27(12-10-24)46(2,43)44/h6-12,19-20,25,37-38H,13-18,21-23H2,1-5H3 |
| InChIKey | SZOJFQDUWRKDQJ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.91 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|