C13H13N5O3 — CID 157047758
[3-(1-ethyl-4-nitroindol-2-yl)-1,2,4-oxadiazol-5-yl]methanamine (PubChem CID 157047758) has the molecular formula C13H13N5O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is [3-(1-ethyl-4-nitroindol-2-yl)-1,2,4-oxadiazol-5-yl]methanamine.
| Compound Name | [3-(1-ethyl-4-nitroindol-2-yl)-1,2,4-oxadiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 157047758 |
| Molecular Formula | C13H13N5O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | [3-(1-ethyl-4-nitroindol-2-yl)-1,2,4-oxadiazol-5-yl]methanamine |
| SMILES | CCn1c(-c2noc(CN)n2)cc2c([N+](=O)[O-])cccc21 |
| InChI | InChI=1S/C13H13N5O3/c1-2-17-9-4-3-5-10(18(19)20)8(9)6-11(17)13-15-12(7-14)21-16-13/h3-6H,2,7,14H2,1H3 |
| InChIKey | JEKKSVBPKKMGNO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|