C19H25N5O15P2-2 — CID 157049266
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3R,4R)-4-[(E)-but-2-enoyl]oxy-3,5-dihydroxyoxolan-2-yl]methyl phosphate (PubChem CID 157049266) has the molecular formula C19H25N5O15P2-2 and a molecular weight of 625.38 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3R,4R)-4-[(E)-but-2-enoyl]oxy-3,5-dihydroxyoxolan-2-yl]methyl phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3R,4R)-4-[(E)-but-2-enoyl]oxy-3,5-dihydroxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 157049266 |
| Molecular Formula | C19H25N5O15P2-2 |
| Molecular Weight | 625.38 g/mol |
| Exact Mass | 625.08 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] [(2R,3R,4R)-4-[(E)-but-2-enoyl]oxy-3,5-dihydroxyoxolan-2-yl]methyl phosphate |
| SMILES | C/C=C/C(=O)O[C@H]1C(O)O[C@H](COP(=O)([O-])OP(=O)([O-])OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)[C@H]1O |
| InChI | InChI=1S/C19H27N5O15P2/c1-2-3-10(25)38-15-13(27)9(37-19(15)29)5-35-41(32,33)39-40(30,31)34-4-8-12(26)14(28)18(36-8)24-7-23-11-16(20)21-6-22-17(11)24/h2-3,6-9,12-15,18-19,26-29H,4-5H2,1H3,(H,30,31)(H,32,33)(H2,20,21,22)/p-2/b3-2+/t8-,9-,12-,13-,14-,15-,18-,19?/m1/s1 |
| InChIKey | HWEPUSWATFRHSJ-UDCOKLPCSA-L |
| XLogP | -3.42 |
| TPSA | 303.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.38 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|