About methyl acetate;methyl 2-(methylamino)acetate;methyl 1-methylpiperidine-4-carboxylate
methyl acetate;methyl 2-(methylamino)acetate;methyl 1-methylpiperidine-4-carboxylate (PubChem CID 157053310) has the molecular formula C18H36N2O8
and a molecular weight of 408.49 g/mol. Its IUPAC name is methyl acetate;methyl 2-(methylamino)acetate;methyl 1-methylpiperidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl acetate;methyl 2-(methylamino)acetate;methyl 1-methylpiperidine-4-carboxylate |
| PubChem CID | 157053310 |
| Molecular Formula | C18H36N2O8 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | methyl acetate;methyl 2-(methylamino)acetate;methyl 1-methylpiperidine-4-carboxylate |
| SMILES | CNCC(=O)OC.COC(=O)C1CCN(C)CC1.COC(C)=O.COC(C)=O |
| InChI | InChI=1S/C8H15NO2.C4H9NO2.2C3H6O2/c1-9-5-3-7(4-6-9)8(10)11-2;1-5-3-4(6)7-2;2*1-3(4)5-2/h7H,3-6H2,1-2H3;5H,3H2,1-2H3;2*1-2H3 |
| InChIKey | AALQTYPMWWSDAH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze methyl acetate;methyl 2-(methylamino)acetate;methyl 1-methylpiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl acetate;methyl 2-(methylamino)acetate;methyl 1-methylpiperidine-4-carboxylate?
The IUPAC name of methyl acetate;methyl 2-(methylamino)acetate;methyl 1-methylpiperidine-4-carboxylate (CID 157053310) is methyl acetate;methyl 2-(methylamino)acetate;methyl 1-methylpiperidine-4-carboxylate.
What is the SMILES notation for methyl acetate;methyl 2-(methylamino)acetate;methyl 1-methylpiperidine-4-carboxylate?
The canonical SMILES for methyl acetate;methyl 2-(methylamino)acetate;methyl 1-methylpiperidine-4-carboxylate is CNCC(=O)OC.COC(=O)C1CCN(C)CC1.COC(C)=O.COC(C)=O.
What is the InChIKey of methyl acetate;methyl 2-(methylamino)acetate;methyl 1-methylpiperidine-4-carboxylate?
The InChIKey is AALQTYPMWWSDAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C4H9NO2.2C3H6O2/c1-9-5-3-7(4-6-9)8(10)11-2;1-5-3-4(6)7-2;2*1-3(4)5-2/h7H,3-6H2,1-2H3;5H,3H2,1-2H3;2*1-2H3.
What are the key properties of methyl acetate;methyl 2-(methylamino)acetate;methyl 1-methylpiperidine-4-carboxylate?
methyl acetate;methyl 2-(methylamino)acetate;methyl 1-methylpiperidine-4-carboxylate has a molecular weight of 408.49 g/mol, XLogP of 0.24, 3 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for methyl acetate;methyl 2-(methylamino)acetate;methyl 1-methylpiperidine-4-carboxylate is sourced from PubChem (CID 157053310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).