C17H29BN2O3 — CID 157055493
[5-amino-7-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]heptyl]boronic acid (PubChem CID 157055493) has the molecular formula C17H29BN2O3 and a molecular weight of 320.24 g/mol. Its IUPAC name is [5-amino-7-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]heptyl]boronic acid.
| Compound Name | [5-amino-7-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]heptyl]boronic acid |
|---|---|
| PubChem CID | 157055493 |
| Molecular Formula | C17H29BN2O3 |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | [5-amino-7-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]heptyl]boronic acid |
| SMILES | NC(CCCCB(O)O)CCN1Cc2ccccc2C[C@H]1CO |
| InChI | InChI=1S/C17H29BN2O3/c19-16(7-3-4-9-18(22)23)8-10-20-12-15-6-2-1-5-14(15)11-17(20)13-21/h1-2,5-6,16-17,21-23H,3-4,7-13,19H2/t16?,17-/m0/s1 |
| InChIKey | ZDYYRGGLMRNADD-DJNXLDHESA-N |
| XLogP | 0.77 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|