C21H33BN2O4 — CID 158365054
[5-amino-5-[3-[2-(1,2,3,4-tetrahydroisoquinolin-3-yl)ethyl]cyclobutyl]pentyl]boronic acid;carbon dioxide (PubChem CID 158365054) has the molecular formula C21H33BN2O4 and a molecular weight of 388.32 g/mol. Its IUPAC name is [5-amino-5-[3-[2-(1,2,3,4-tetrahydroisoquinolin-3-yl)ethyl]cyclobutyl]pentyl]boronic acid;carbon dioxide.
| Compound Name | [5-amino-5-[3-[2-(1,2,3,4-tetrahydroisoquinolin-3-yl)ethyl]cyclobutyl]pentyl]boronic acid;carbon dioxide |
|---|---|
| PubChem CID | 158365054 |
| Molecular Formula | C21H33BN2O4 |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | [5-amino-5-[3-[2-(1,2,3,4-tetrahydroisoquinolin-3-yl)ethyl]cyclobutyl]pentyl]boronic acid;carbon dioxide |
| SMILES | NC(CCCCB(O)O)C1CC(CCC2Cc3ccccc3CN2)C1.O=C=O |
| InChI | InChI=1S/C20H33BN2O2.CO2/c22-20(7-3-4-10-21(24)25)18-11-15(12-18)8-9-19-13-16-5-1-2-6-17(16)14-23-19;2-1-3/h1-2,5-6,15,18-20,23-25H,3-4,7-14,22H2; |
| InChIKey | GTXWFTQXVUEKNJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|