C29H43F6O2Si2 — CID 157055596
CID 157055596 (PubChem CID 157055596) has the molecular formula C29H43F6O2Si2 and a molecular weight of 593.82 g/mol.
| Compound Name | CID 157055596 |
|---|---|
| PubChem CID | 157055596 |
| Molecular Formula | C29H43F6O2Si2 |
| Molecular Weight | 593.82 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | — |
| SMILES | CC[Si](CC)CCc1cccc(C(F)(F)F)c1.COO[Si](CCc1cccc(C(F)(F)F)c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H25F3O2Si.C13H18F3Si/c1-12(2)22(13(3)4,21-20-5)10-9-14-7-6-8-15(11-14)16(17,18)19;1-3-17(4-2)9-8-11-6-5-7-12(10-11)13(14,15)16/h6-8,11-13H,9-10H2,1-5H3;5-7,10H,3-4,8-9H2,1-2H3 |
| InChIKey | AEQXKAJYBFKDRO-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.82 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|