C11H22O2 — CID 157055954
4,4-bis(methoxymethyl)cyclohexene;methane (PubChem CID 157055954) has the molecular formula C11H22O2 and a molecular weight of 186.30 g/mol. Its IUPAC name is 4,4-bis(methoxymethyl)cyclohexene;methane.
| Compound Name | 4,4-bis(methoxymethyl)cyclohexene;methane |
|---|---|
| PubChem CID | 157055954 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 4,4-bis(methoxymethyl)cyclohexene;methane |
| SMILES | C.COCC1(COC)CC=CCC1 |
| InChI | InChI=1S/C10H18O2.CH4/c1-11-8-10(9-12-2)6-4-3-5-7-10;/h3-4H,5-9H2,1-2H3;1H4 |
| InChIKey | AATJKBUPUCTGIW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|