C16H30O2Sn — CID 18766957
3,3-dibutyl-2,4-dioxa-3-stannaspiro[5.5]undec-9-ene (PubChem CID 18766957) has the molecular formula C16H30O2Sn and a molecular weight of 373.13 g/mol. Its IUPAC name is 3,3-dibutyl-2,4-dioxa-3-stannaspiro[5.5]undec-9-ene.
| Compound Name | 3,3-dibutyl-2,4-dioxa-3-stannaspiro[5.5]undec-9-ene |
|---|---|
| PubChem CID | 18766957 |
| Molecular Formula | C16H30O2Sn |
| Molecular Weight | 373.13 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 3,3-dibutyl-2,4-dioxa-3-stannaspiro[5.5]undec-9-ene |
| SMILES | CCCC[Sn]1(CCCC)OCC2(CC=CCC2)CO1 |
| InChI | InChI=1S/C8H12O2.2C4H9.Sn/c9-6-8(7-10)4-2-1-3-5-8;2*1-3-4-2;/h1-2H,3-7H2;2*1,3-4H2,2H3;/q-2;;;+2 |
| InChIKey | BIDNWKYKDJAFGW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.13 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|