C13H22O2 — CID 135008981
3-ethenyl-5,5-bis(methoxymethyl)-1-methylcyclohexene (PubChem CID 135008981) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-ethenyl-5,5-bis(methoxymethyl)-1-methylcyclohexene.
| Compound Name | 3-ethenyl-5,5-bis(methoxymethyl)-1-methylcyclohexene |
|---|---|
| PubChem CID | 135008981 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 3-ethenyl-5,5-bis(methoxymethyl)-1-methylcyclohexene |
| SMILES | C=CC1C=C(C)CC(COC)(COC)C1 |
| InChI | InChI=1S/C13H22O2/c1-5-12-6-11(2)7-13(8-12,9-14-3)10-15-4/h5-6,12H,1,7-10H2,2-4H3 |
| InChIKey | HVNMWJVFTCVXQN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|