C11H20O — CID 157057369
(4R)-4-cyclopropyl-2,5-dimethylhexan-3-one (PubChem CID 157057369) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (4R)-4-cyclopropyl-2,5-dimethylhexan-3-one.
| Compound Name | (4R)-4-cyclopropyl-2,5-dimethylhexan-3-one |
|---|---|
| PubChem CID | 157057369 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (4R)-4-cyclopropyl-2,5-dimethylhexan-3-one |
| SMILES | CC(C)C(=O)[C@H](C(C)C)C1CC1 |
| InChI | InChI=1S/C11H20O/c1-7(2)10(9-5-6-9)11(12)8(3)4/h7-10H,5-6H2,1-4H3/t10-/m1/s1 |
| InChIKey | RQLZLNUPFOTDJQ-SNVBAGLBSA-N |
| XLogP | 2.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |