About ethyl formate;1H-indol-5-amine
ethyl formate;1H-indol-5-amine (PubChem CID 157059520) has the molecular formula C11H14N2O2
and a molecular weight of 206.24 g/mol. Its IUPAC name is ethyl formate;1H-indol-5-amine.
Molecular Properties
| Compound Name | ethyl formate;1H-indol-5-amine |
| PubChem CID | 157059520 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | ethyl formate;1H-indol-5-amine |
| SMILES | CCOC=O.Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H8N2.C3H6O2/c9-7-1-2-8-6(5-7)3-4-10-8;1-2-5-3-4/h1-5,10H,9H2;3H,2H2,1H3 |
| InChIKey | ABDVVAFOHPYWEO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl formate;1H-indol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl formate;1H-indol-5-amine?
The IUPAC name of ethyl formate;1H-indol-5-amine (CID 157059520) is ethyl formate;1H-indol-5-amine.
What is the SMILES notation for ethyl formate;1H-indol-5-amine?
The canonical SMILES for ethyl formate;1H-indol-5-amine is CCOC=O.Nc1ccc2[nH]ccc2c1.
What is the InChIKey of ethyl formate;1H-indol-5-amine?
The InChIKey is ABDVVAFOHPYWEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.C3H6O2/c9-7-1-2-8-6(5-7)3-4-10-8;1-2-5-3-4/h1-5,10H,9H2;3H,2H2,1H3.
What are the key properties of ethyl formate;1H-indol-5-amine?
ethyl formate;1H-indol-5-amine has a molecular weight of 206.24 g/mol, XLogP of 1.93, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;1H-indol-5-amine is sourced from PubChem (CID 157059520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).