C16H14F3NO2 — CID 157060389
1,1,2-trifluoroethyl N-[(4-phenylphenyl)methyl]carbamate (PubChem CID 157060389) has the molecular formula C16H14F3NO2 and a molecular weight of 309.29 g/mol. Its IUPAC name is 1,1,2-trifluoroethyl N-[(4-phenylphenyl)methyl]carbamate.
| Compound Name | 1,1,2-trifluoroethyl N-[(4-phenylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 157060389 |
| Molecular Formula | C16H14F3NO2 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 1,1,2-trifluoroethyl N-[(4-phenylphenyl)methyl]carbamate |
| SMILES | O=C(NCc1ccc(-c2ccccc2)cc1)OC(F)(F)CF |
| InChI | InChI=1S/C16H14F3NO2/c17-11-16(18,19)22-15(21)20-10-12-6-8-14(9-7-12)13-4-2-1-3-5-13/h1-9H,10-11H2,(H,20,21) |
| InChIKey | ABGOQRAIIDKIMM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |