C29H27FN2O — CID 132568184
(2S)-N-[[4-(aminomethyl)phenyl]methyl]-2-fluoro-3-phenyl-2-(4-phenylphenyl)propanamide (PubChem CID 132568184) has the molecular formula C29H27FN2O and a molecular weight of 438.55 g/mol. Its IUPAC name is (2S)-N-[[4-(aminomethyl)phenyl]methyl]-2-fluoro-3-phenyl-2-(4-phenylphenyl)propanamide.
| Compound Name | (2S)-N-[[4-(aminomethyl)phenyl]methyl]-2-fluoro-3-phenyl-2-(4-phenylphenyl)propanamide |
|---|---|
| PubChem CID | 132568184 |
| Molecular Formula | C29H27FN2O |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | (2S)-N-[[4-(aminomethyl)phenyl]methyl]-2-fluoro-3-phenyl-2-(4-phenylphenyl)propanamide |
| SMILES | NCc1ccc(CNC(=O)[C@](F)(Cc2ccccc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H27FN2O/c30-29(19-22-7-3-1-4-8-22,28(33)32-21-24-13-11-23(20-31)12-14-24)27-17-15-26(16-18-27)25-9-5-2-6-10-25/h1-18H,19-21,31H2,(H,32,33)/t29-/m0/s1 |
| InChIKey | BMSUQJATLBZTJI-LJAQVGFWSA-N |
| XLogP | 5.54 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |