C74H51ClN6O6 — CID 157063536
1-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]naphthalen-2-ol;2-chloro-4,6-bis(4-phenoxyphenyl)-1,3,5-triazine;naphthalen-2-ol (PubChem CID 157063536) has the molecular formula C74H51ClN6O6 and a molecular weight of 1155.71 g/mol. Its IUPAC name is 1-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]naphthalen-2-ol;2-chloro-4,6-bis(4-phenoxyphenyl)-1,3,5-triazine;naphthalen-2-ol.
| Compound Name | 1-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]naphthalen-2-ol;2-chloro-4,6-bis(4-phenoxyphenyl)-1,3,5-triazine;naphthalen-2-ol |
|---|---|
| PubChem CID | 157063536 |
| Molecular Formula | C74H51ClN6O6 |
| Molecular Weight | 1155.71 g/mol |
| Exact Mass | 1154.36 |
| IUPAC Name | 1-[4,6-bis(4-phenoxyphenyl)-1,3,5-triazin-2-yl]naphthalen-2-ol;2-chloro-4,6-bis(4-phenoxyphenyl)-1,3,5-triazine;naphthalen-2-ol |
| SMILES | Clc1nc(-c2ccc(Oc3ccccc3)cc2)nc(-c2ccc(Oc3ccccc3)cc2)n1.Oc1ccc2ccccc2c1.Oc1ccc2ccccc2c1-c1nc(-c2ccc(Oc3ccccc3)cc2)nc(-c2ccc(Oc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C37H25N3O3.C27H18ClN3O2.C10H8O/c41-33-24-19-25-9-7-8-14-32(25)34(33)37-39-35(26-15-20-30(21-16-26)42-28-10-3-1-4-11-28)38-36(40-37)27-17-22-31(23-18-27)43-29-12-5-2-6-13-29;28-27-30-25(19-11-15-23(16-12-19)32-21-7-3-1-4-8-21)29-26(31-27)20-13-17-24(18-14-20)33-22-9-5-2-6-10-22;11-10-6-5-8-3-1-2-4-9(8)7-10/h1-24,41H;1-18H;1-7,11H |
| InChIKey | ABPJBDANQKHTCL-UHFFFAOYSA-N |
| XLogP | 19.31 |
| TPSA | 154.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 87 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1155.71 |
| LogP ≤ 5 | 19.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |