C9H18O3 — CID 157065272
1-[1-(hydroxymethyl)cyclohexyl]ethane-1,2-diol (PubChem CID 157065272) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is 1-[1-(hydroxymethyl)cyclohexyl]ethane-1,2-diol.
| Compound Name | 1-[1-(hydroxymethyl)cyclohexyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 157065272 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 1-[1-(hydroxymethyl)cyclohexyl]ethane-1,2-diol |
| SMILES | OCC(O)C1(CO)CCCCC1 |
| InChI | InChI=1S/C9H18O3/c10-6-8(12)9(7-11)4-2-1-3-5-9/h8,10-12H,1-7H2 |
| InChIKey | JNCASFSYPGXKKJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |