C8H17NO3 — CID 154222785
1-[4-(hydroxymethyl)piperidin-4-yl]ethane-1,2-diol (PubChem CID 154222785) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-[4-(hydroxymethyl)piperidin-4-yl]ethane-1,2-diol.
| Compound Name | 1-[4-(hydroxymethyl)piperidin-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 154222785 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 1-[4-(hydroxymethyl)piperidin-4-yl]ethane-1,2-diol |
| SMILES | OCC(O)C1(CO)CCNCC1 |
| InChI | InChI=1S/C8H17NO3/c10-5-7(12)8(6-11)1-3-9-4-2-8/h7,9-12H,1-6H2 |
| InChIKey | MBBCNGTTWXZQOJ-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |