C14H28O4 — CID 123228794
1-[1,4-bis(hydroxymethyl)cyclohexyl]hexane-1,6-diol (PubChem CID 123228794) has the molecular formula C14H28O4 and a molecular weight of 260.37 g/mol. Its IUPAC name is 1-[1,4-bis(hydroxymethyl)cyclohexyl]hexane-1,6-diol.
| Compound Name | 1-[1,4-bis(hydroxymethyl)cyclohexyl]hexane-1,6-diol |
|---|---|
| PubChem CID | 123228794 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 1-[1,4-bis(hydroxymethyl)cyclohexyl]hexane-1,6-diol |
| SMILES | OCCCCCC(O)C1(CO)CCC(CO)CC1 |
| InChI | InChI=1S/C14H28O4/c15-9-3-1-2-4-13(18)14(11-17)7-5-12(10-16)6-8-14/h12-13,15-18H,1-11H2 |
| InChIKey | DMGHBZMAVMRABJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|