C7H15NO4 — CID 24858444
(3R,4R)-4-[(1S)-1,2-dihydroxyethyl]piperidine-3,4-diol (PubChem CID 24858444) has the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. Its IUPAC name is (3R,4R)-4-[(1S)-1,2-dihydroxyethyl]piperidine-3,4-diol.
| Compound Name | (3R,4R)-4-[(1S)-1,2-dihydroxyethyl]piperidine-3,4-diol |
|---|---|
| PubChem CID | 24858444 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | (3R,4R)-4-[(1S)-1,2-dihydroxyethyl]piperidine-3,4-diol |
| SMILES | OC[C@H](O)[C@@]1(O)CCNC[C@H]1O |
| InChI | InChI=1S/C7H15NO4/c9-4-6(11)7(12)1-2-8-3-5(7)10/h5-6,8-12H,1-4H2/t5-,6+,7-/m1/s1 |
| InChIKey | IRFJUFYOWXVCEX-DSYKOEDSSA-N |
| XLogP | -2.58 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |