C29H27N3S — CID 157068322
2-propan-2-yl-5-[5-(2-propan-2-yl-3H-pyrrol-4-yl)phenanthro[10,9-b]thiophen-10-yl]-1H-imidazole (PubChem CID 157068322) has the molecular formula C29H27N3S and a molecular weight of 449.62 g/mol. Its IUPAC name is 2-propan-2-yl-5-[5-(2-propan-2-yl-3H-pyrrol-4-yl)phenanthro[10,9-b]thiophen-10-yl]-1H-imidazole.
| Compound Name | 2-propan-2-yl-5-[5-(2-propan-2-yl-3H-pyrrol-4-yl)phenanthro[10,9-b]thiophen-10-yl]-1H-imidazole |
|---|---|
| PubChem CID | 157068322 |
| Molecular Formula | C29H27N3S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 2-propan-2-yl-5-[5-(2-propan-2-yl-3H-pyrrol-4-yl)phenanthro[10,9-b]thiophen-10-yl]-1H-imidazole |
| SMILES | CC(C)C1=NC=C(c2ccc3c(c2)c2ccsc2c2cc(-c4cnc(C(C)C)[nH]4)ccc32)C1 |
| InChI | InChI=1S/C29H27N3S/c1-16(2)26-13-20(14-30-26)18-5-7-21-22-8-6-19(27-15-31-29(32-27)17(3)4)12-25(22)28-23(9-10-33-28)24(21)11-18/h5-12,14-17H,13H2,1-4H3,(H,31,32) |
| InChIKey | AYFXVLZYIGXZGV-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|