C29H27N5 — CID 159065421
11-(2-propan-2-yl-1H-imidazol-5-yl)-6-(2-propan-2-yl-3H-pyrrol-4-yl)phenanthro[9,10-d]pyrimidine (PubChem CID 159065421) has the molecular formula C29H27N5 and a molecular weight of 445.57 g/mol. Its IUPAC name is 11-(2-propan-2-yl-1H-imidazol-5-yl)-6-(2-propan-2-yl-3H-pyrrol-4-yl)phenanthro[9,10-d]pyrimidine.
| Compound Name | 11-(2-propan-2-yl-1H-imidazol-5-yl)-6-(2-propan-2-yl-3H-pyrrol-4-yl)phenanthro[9,10-d]pyrimidine |
|---|---|
| PubChem CID | 159065421 |
| Molecular Formula | C29H27N5 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 11-(2-propan-2-yl-1H-imidazol-5-yl)-6-(2-propan-2-yl-3H-pyrrol-4-yl)phenanthro[9,10-d]pyrimidine |
| SMILES | CC(C)C1=NC=C(c2ccc3c(c2)c2cncnc2c2cc(-c4cnc(C(C)C)[nH]4)ccc32)C1 |
| InChI | InChI=1S/C29H27N5/c1-16(2)26-11-20(12-31-26)18-5-7-21-22-8-6-19(27-14-32-29(34-27)17(3)4)10-24(22)28-25(23(21)9-18)13-30-15-33-28/h5-10,12-17H,11H2,1-4H3,(H,32,34) |
| InChIKey | MZWLRLYBCAKECJ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|