C19H30O5 — CID 157070260
2-[2-(2,2-dimethylhex-5-enoxy)-2-oxoethyl]-7-methyl-5-oxooct-6-enoic acid (PubChem CID 157070260) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is 2-[2-(2,2-dimethylhex-5-enoxy)-2-oxoethyl]-7-methyl-5-oxooct-6-enoic acid.
| Compound Name | 2-[2-(2,2-dimethylhex-5-enoxy)-2-oxoethyl]-7-methyl-5-oxooct-6-enoic acid |
|---|---|
| PubChem CID | 157070260 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-[2-(2,2-dimethylhex-5-enoxy)-2-oxoethyl]-7-methyl-5-oxooct-6-enoic acid |
| SMILES | C=CCCC(C)(C)COC(=O)CC(CCC(=O)C=C(C)C)C(=O)O |
| InChI | InChI=1S/C19H30O5/c1-6-7-10-19(4,5)13-24-17(21)12-15(18(22)23)8-9-16(20)11-14(2)3/h6,11,15H,1,7-10,12-13H2,2-5H3,(H,22,23) |
| InChIKey | APMWLQJICZSNDH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|