C24H38O4 — CID 162926751
(9R,12R,15R)-2,9,12,15-tetramethylicosa-2,19-diene-4,7,10,13-tetrone (PubChem CID 162926751) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is (9R,12R,15R)-2,9,12,15-tetramethylicosa-2,19-diene-4,7,10,13-tetrone.
| Compound Name | (9R,12R,15R)-2,9,12,15-tetramethylicosa-2,19-diene-4,7,10,13-tetrone |
|---|---|
| PubChem CID | 162926751 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | (9R,12R,15R)-2,9,12,15-tetramethylicosa-2,19-diene-4,7,10,13-tetrone |
| SMILES | C=CCCC[C@@H](C)CC(=O)[C@H](C)CC(=O)[C@H](C)CC(=O)CCC(=O)C=C(C)C |
| InChI | InChI=1S/C24H38O4/c1-7-8-9-10-18(4)14-23(27)20(6)16-24(28)19(5)15-22(26)12-11-21(25)13-17(2)3/h7,13,18-20H,1,8-12,14-16H2,2-6H3/t18-,19-,20-/m1/s1 |
| InChIKey | VDQWQEZDNGORHV-VAMGGRTRSA-N |
| XLogP | 5.44 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|